C44H78N2+2 — CID 139990602
hexyl-[[4-[4-[(hexyl-methyl-octylazaniumyl)methyl]phenyl]phenyl]methyl]-methyl-octylazanium (PubChem CID 139990602) has the molecular formula C44H78N2+2 and a molecular weight of 635.12 g/mol. Its IUPAC name is hexyl-[[4-[4-[(hexyl-methyl-octylazaniumyl)methyl]phenyl]phenyl]methyl]-methyl-octylazanium.
| Compound Name | hexyl-[[4-[4-[(hexyl-methyl-octylazaniumyl)methyl]phenyl]phenyl]methyl]-methyl-octylazanium |
|---|---|
| PubChem CID | 139990602 |
| Molecular Formula | C44H78N2+2 |
| Molecular Weight | 635.12 g/mol |
| Exact Mass | 634.62 |
| IUPAC Name | hexyl-[[4-[4-[(hexyl-methyl-octylazaniumyl)methyl]phenyl]phenyl]methyl]-methyl-octylazanium |
| SMILES | CCCCCCCC[N+](C)(CCCCCC)Cc1ccc(-c2ccc(C[N+](C)(CCCCCC)CCCCCCCC)cc2)cc1 |
| InChI | InChI=1S/C44H78N2/c1-7-11-15-19-21-25-37-45(5,35-23-17-13-9-3)39-41-27-31-43(32-28-41)44-33-29-42(30-34-44)40-46(6,36-24-18-14-10-4)38-26-22-20-16-12-8-2/h27-34H,7-26,35-40H2,1-6H3/q+2 |
| InChIKey | UNTIROUCOHBSPC-UHFFFAOYSA-N |
| XLogP | 13.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 29 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.12 |
| LogP ≤ 5 | 13.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|