C38H66Cl2N2 — CID 10461558
decyl-[[4-[4-[[decyl(dimethyl)azaniumyl]methyl]phenyl]phenyl]methyl]-dimethylazanium dichloride (PubChem CID 10461558) has the molecular formula C38H66Cl2N2 and a molecular weight of 621.87 g/mol. Its IUPAC name is decyl-[[4-[4-[[decyl(dimethyl)azaniumyl]methyl]phenyl]phenyl]methyl]-dimethylazanium dichloride.
| Compound Name | decyl-[[4-[4-[[decyl(dimethyl)azaniumyl]methyl]phenyl]phenyl]methyl]-dimethylazanium dichloride |
|---|---|
| PubChem CID | 10461558 |
| Molecular Formula | C38H66Cl2N2 |
| Molecular Weight | 621.87 g/mol |
| Exact Mass | 620.46 |
| IUPAC Name | decyl-[[4-[4-[[decyl(dimethyl)azaniumyl]methyl]phenyl]phenyl]methyl]-dimethylazanium dichloride |
| SMILES | CCCCCCCCCC[N+](C)(C)Cc1ccc(-c2ccc(C[N+](C)(C)CCCCCCCCCC)cc2)cc1.[Cl-].[Cl-] |
| InChI | InChI=1S/C38H66N2.2ClH/c1-7-9-11-13-15-17-19-21-31-39(3,4)33-35-23-27-37(28-24-35)38-29-25-36(26-30-38)34-40(5,6)32-22-20-18-16-14-12-10-8-2;;/h23-30H,7-22,31-34H2,1-6H3;2*1H/q+2;;/p-2 |
| InChIKey | YERFTHHVKDKPPP-UHFFFAOYSA-L |
| XLogP | 4.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 23 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.87 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|