C20H25NO — CID 3061929
2-[N-butyl-C-(2,4-dimethylphenyl)carbonimidoyl]-4-methylphenol (PubChem CID 3061929) has the molecular formula C20H25NO and a molecular weight of 295.43 g/mol. Its IUPAC name is 2-[N-butyl-C-(2,4-dimethylphenyl)carbonimidoyl]-4-methylphenol.
| Compound Name | 2-[N-butyl-C-(2,4-dimethylphenyl)carbonimidoyl]-4-methylphenol |
|---|---|
| PubChem CID | 3061929 |
| Molecular Formula | C20H25NO |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | 2-[N-butyl-C-(2,4-dimethylphenyl)carbonimidoyl]-4-methylphenol |
| SMILES | CCCC/N=C(\c1ccc(C)cc1C)c1cc(C)ccc1O |
| InChI | InChI=1S/C20H25NO/c1-5-6-11-21-20(17-9-7-14(2)12-16(17)4)18-13-15(3)8-10-19(18)22/h7-10,12-13,22H,5-6,11H2,1-4H3/b21-20+ |
| InChIKey | KGNGSAXTZRXMCI-QZQOTICOSA-N |
| XLogP | 4.95 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|