About dihydroxy(oxo)azanium;2-[(E)-[phenyl(thiophen-2-yl)methylidene]amino]guanidine
dihydroxy(oxo)azanium;2-[(E)-[phenyl(thiophen-2-yl)methylidene]amino]guanidine (PubChem CID 126960446) has the molecular formula C12H14N5O3S+
and a molecular weight of 308.34 g/mol. Its IUPAC name is dihydroxy(oxo)azanium;2-[(E)-[phenyl(thiophen-2-yl)methylidene]amino]guanidine.
Molecular Properties
| Compound Name | dihydroxy(oxo)azanium;2-[(E)-[phenyl(thiophen-2-yl)methylidene]amino]guanidine |
| PubChem CID | 126960446 |
| Molecular Formula | C12H14N5O3S+ |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | dihydroxy(oxo)azanium;2-[(E)-[phenyl(thiophen-2-yl)methylidene]amino]guanidine |
| SMILES | NC(N)=N/N=C(\c1ccccc1)c1cccs1.O=[N+](O)O |
| InChI | InChI=1S/C12H12N4S.H2NO3/c13-12(14)16-15-11(10-7-4-8-17-10)9-5-2-1-3-6-9;2-1(3)4/h1-8H,(H4,13,14,16);(H2,2,3,4)/q;+1/b15-11+; |
| InChIKey | AVWXSNYFPSFLOQ-KRWCAOSLSA-N |
| XLogP | 1.32 |
| TPSA | 137.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze dihydroxy(oxo)azanium;2-[(E)-[phenyl(thiophen-2-yl)methylidene]amino]guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dihydroxy(oxo)azanium;2-[(E)-[phenyl(thiophen-2-yl)methylidene]amino]guanidine?
The IUPAC name of dihydroxy(oxo)azanium;2-[(E)-[phenyl(thiophen-2-yl)methylidene]amino]guanidine (CID 126960446) is dihydroxy(oxo)azanium;2-[(E)-[phenyl(thiophen-2-yl)methylidene]amino]guanidine.
What is the SMILES notation for dihydroxy(oxo)azanium;2-[(E)-[phenyl(thiophen-2-yl)methylidene]amino]guanidine?
The canonical SMILES for dihydroxy(oxo)azanium;2-[(E)-[phenyl(thiophen-2-yl)methylidene]amino]guanidine is NC(N)=N/N=C(\c1ccccc1)c1cccs1.O=[N+](O)O.
What is the InChIKey of dihydroxy(oxo)azanium;2-[(E)-[phenyl(thiophen-2-yl)methylidene]amino]guanidine?
The InChIKey is AVWXSNYFPSFLOQ-KRWCAOSLSA-N. The full InChI is InChI=1S/C12H12N4S.H2NO3/c13-12(14)16-15-11(10-7-4-8-17-10)9-5-2-1-3-6-9;2-1(3)4/h1-8H,(H4,13,14,16);(H2,2,3,4)/q;+1/b15-11+;.
What are the key properties of dihydroxy(oxo)azanium;2-[(E)-[phenyl(thiophen-2-yl)methylidene]amino]guanidine?
dihydroxy(oxo)azanium;2-[(E)-[phenyl(thiophen-2-yl)methylidene]amino]guanidine has a molecular weight of 308.34 g/mol, XLogP of 1.32, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dihydroxy(oxo)azanium;2-[(E)-[phenyl(thiophen-2-yl)methylidene]amino]guanidine is sourced from PubChem (CID 126960446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).