C13H6ClF5 — CID 134625909
2-chloro-1,3-difluoro-4-[4-(trifluoromethyl)phenyl]benzene (PubChem CID 134625909) has the molecular formula C13H6ClF5 and a molecular weight of 292.63 g/mol. Its IUPAC name is 2-chloro-1,3-difluoro-4-[4-(trifluoromethyl)phenyl]benzene.
| Compound Name | 2-chloro-1,3-difluoro-4-[4-(trifluoromethyl)phenyl]benzene |
|---|---|
| PubChem CID | 134625909 |
| Molecular Formula | C13H6ClF5 |
| Molecular Weight | 292.63 g/mol |
| Exact Mass | 292.01 |
| IUPAC Name | 2-chloro-1,3-difluoro-4-[4-(trifluoromethyl)phenyl]benzene |
| SMILES | Fc1ccc(-c2ccc(C(F)(F)F)cc2)c(F)c1Cl |
| InChI | InChI=1S/C13H6ClF5/c14-11-10(15)6-5-9(12(11)16)7-1-3-8(4-2-7)13(17,18)19/h1-6H |
| InChIKey | LEBRNNOHCADVIK-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.63 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|