C21H12Cl2FNO3 — CID 174894059
cyclohexa-2,5-diene-1,4-dione;5,7-dichloro-4-(4-fluorophenoxy)quinoline (PubChem CID 174894059) has the molecular formula C21H12Cl2FNO3 and a molecular weight of 416.24 g/mol. Its IUPAC name is cyclohexa-2,5-diene-1,4-dione;5,7-dichloro-4-(4-fluorophenoxy)quinoline.
| Compound Name | cyclohexa-2,5-diene-1,4-dione;5,7-dichloro-4-(4-fluorophenoxy)quinoline |
|---|---|
| PubChem CID | 174894059 |
| Molecular Formula | C21H12Cl2FNO3 |
| Molecular Weight | 416.24 g/mol |
| Exact Mass | 415.02 |
| IUPAC Name | cyclohexa-2,5-diene-1,4-dione;5,7-dichloro-4-(4-fluorophenoxy)quinoline |
| SMILES | Fc1ccc(Oc2ccnc3cc(Cl)cc(Cl)c23)cc1.O=C1C=CC(=O)C=C1 |
| InChI | InChI=1S/C15H8Cl2FNO.C6H4O2/c16-9-7-12(17)15-13(8-9)19-6-5-14(15)20-11-3-1-10(18)2-4-11;7-5-1-2-6(8)4-3-5/h1-8H;1-4H |
| InChIKey | QIZCJSXCUNFXEB-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.24 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|