C29H23Cl4FN4O2S — CID 87072831
2-[2-(1-chlorocyclopropyl)-3-(2-chlorophenyl)-2-hydroxypropyl]-1H-1,2,4-triazole-3-thione;5,7-dichloro-4-(4-fluorophenoxy)quinoline (PubChem CID 87072831) has the molecular formula C29H23Cl4FN4O2S and a molecular weight of 652.41 g/mol. Its IUPAC name is 2-[2-(1-chlorocyclopropyl)-3-(2-chlorophenyl)-2-hydroxypropyl]-1H-1,2,4-triazole-3-thione;5,7-dichloro-4-(4-fluorophenoxy)quinoline.
| Compound Name | 2-[2-(1-chlorocyclopropyl)-3-(2-chlorophenyl)-2-hydroxypropyl]-1H-1,2,4-triazole-3-thione;5,7-dichloro-4-(4-fluorophenoxy)quinoline |
|---|---|
| PubChem CID | 87072831 |
| Molecular Formula | C29H23Cl4FN4O2S |
| Molecular Weight | 652.41 g/mol |
| Exact Mass | 650.03 |
| IUPAC Name | 2-[2-(1-chlorocyclopropyl)-3-(2-chlorophenyl)-2-hydroxypropyl]-1H-1,2,4-triazole-3-thione;5,7-dichloro-4-(4-fluorophenoxy)quinoline |
| SMILES | Fc1ccc(Oc2ccnc3cc(Cl)cc(Cl)c23)cc1.OC(Cc1ccccc1Cl)(Cn1[nH]cnc1=S)C1(Cl)CC1 |
| InChI | InChI=1S/C15H8Cl2FNO.C14H15Cl2N3OS/c16-9-7-12(17)15-13(8-9)19-6-5-14(15)20-11-3-1-10(18)2-4-11;15-11-4-2-1-3-10(11)7-14(20,13(16)5-6-13)8-19-12(21)17-9-18-19/h1-8H;1-4,9,20H,5-8H2,(H,17,18,21) |
| InChIKey | DKUQORPCZUJDEG-UHFFFAOYSA-N |
| XLogP | 8.81 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.41 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|