C17H21Cl2N3O2S — CID 160598702
S-[2-[2-(1-chlorocyclopropyl)-3-(2-chlorophenyl)-2-hydroxypropyl]-1,2,4-triazol-3-yl] ethanethioate;methane (PubChem CID 160598702) has the molecular formula C17H21Cl2N3O2S and a molecular weight of 402.35 g/mol. Its IUPAC name is S-[2-[2-(1-chlorocyclopropyl)-3-(2-chlorophenyl)-2-hydroxypropyl]-1,2,4-triazol-3-yl] ethanethioate;methane.
| Compound Name | S-[2-[2-(1-chlorocyclopropyl)-3-(2-chlorophenyl)-2-hydroxypropyl]-1,2,4-triazol-3-yl] ethanethioate;methane |
|---|---|
| PubChem CID | 160598702 |
| Molecular Formula | C17H21Cl2N3O2S |
| Molecular Weight | 402.35 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | S-[2-[2-(1-chlorocyclopropyl)-3-(2-chlorophenyl)-2-hydroxypropyl]-1,2,4-triazol-3-yl] ethanethioate;methane |
| SMILES | C.CC(=O)Sc1ncnn1CC(O)(Cc1ccccc1Cl)C1(Cl)CC1 |
| InChI | InChI=1S/C16H17Cl2N3O2S.CH4/c1-11(22)24-14-19-10-20-21(14)9-16(23,15(18)6-7-15)8-12-4-2-3-5-13(12)17;/h2-5,10,23H,6-9H2,1H3;1H4 |
| InChIKey | RDZFSFMJDNXHSY-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.35 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|