C21H19Cl3N4O2S — CID 20677588
S-[[2-[2-(1-chlorocyclopropyl)-3-(2-chlorophenyl)-2-hydroxypropyl]-1,2,4-triazol-3-yl]] N-(4-chlorophenyl)carbamothioate (PubChem CID 20677588) has the molecular formula C21H19Cl3N4O2S and a molecular weight of 497.84 g/mol. Its IUPAC name is S-[[2-[2-(1-chlorocyclopropyl)-3-(2-chlorophenyl)-2-hydroxypropyl]-1,2,4-triazol-3-yl]] N-(4-chlorophenyl)carbamothioate.
| Compound Name | S-[[2-[2-(1-chlorocyclopropyl)-3-(2-chlorophenyl)-2-hydroxypropyl]-1,2,4-triazol-3-yl]] N-(4-chlorophenyl)carbamothioate |
|---|---|
| PubChem CID | 20677588 |
| Molecular Formula | C21H19Cl3N4O2S |
| Molecular Weight | 497.84 g/mol |
| Exact Mass | 496.03 |
| IUPAC Name | S-[[2-[2-(1-chlorocyclopropyl)-3-(2-chlorophenyl)-2-hydroxypropyl]-1,2,4-triazol-3-yl]] N-(4-chlorophenyl)carbamothioate |
| SMILES | O=C(Nc1ccc(Cl)cc1)Sc1ncnn1CC(O)(Cc1ccccc1Cl)C1(Cl)CC1 |
| InChI | InChI=1S/C21H19Cl3N4O2S/c22-15-5-7-16(8-6-15)27-19(29)31-18-25-13-26-28(18)12-21(30,20(24)9-10-20)11-14-3-1-2-4-17(14)23/h1-8,13,30H,9-12H2,(H,27,29) |
| InChIKey | CYJCWBFWIIIYST-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.84 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|