C20H25Cl2N3O3S — CID 20677595
2-methylbutyl [2-[2-(1-chlorocyclopropyl)-3-(2-chlorophenyl)-2-hydroxypropyl]-1,2,4-triazol-3-yl]sulfanylformate (PubChem CID 20677595) has the molecular formula C20H25Cl2N3O3S and a molecular weight of 458.41 g/mol. Its IUPAC name is 2-methylbutyl [2-[2-(1-chlorocyclopropyl)-3-(2-chlorophenyl)-2-hydroxypropyl]-1,2,4-triazol-3-yl]sulfanylformate.
| Compound Name | 2-methylbutyl [2-[2-(1-chlorocyclopropyl)-3-(2-chlorophenyl)-2-hydroxypropyl]-1,2,4-triazol-3-yl]sulfanylformate |
|---|---|
| PubChem CID | 20677595 |
| Molecular Formula | C20H25Cl2N3O3S |
| Molecular Weight | 458.41 g/mol |
| Exact Mass | 457.10 |
| IUPAC Name | 2-methylbutyl [2-[2-(1-chlorocyclopropyl)-3-(2-chlorophenyl)-2-hydroxypropyl]-1,2,4-triazol-3-yl]sulfanylformate |
| SMILES | CCC(C)COC(=O)Sc1ncnn1CC(O)(Cc1ccccc1Cl)C1(Cl)CC1 |
| InChI | InChI=1S/C20H25Cl2N3O3S/c1-3-14(2)11-28-18(26)29-17-23-13-24-25(17)12-20(27,19(22)8-9-19)10-15-6-4-5-7-16(15)21/h4-7,13-14,27H,3,8-12H2,1-2H3 |
| InChIKey | BRGKHWDKRHRUMU-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.41 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|