C15H19Cl2N3OS — CID 175185202
2-[2-(1-chlorocyclopropyl)-3-(2-chlorophenyl)-2-hydroxypropyl]-1,2,4-triazolidine-3-carbothialdehyde (PubChem CID 175185202) has the molecular formula C15H19Cl2N3OS and a molecular weight of 360.31 g/mol. Its IUPAC name is 2-[2-(1-chlorocyclopropyl)-3-(2-chlorophenyl)-2-hydroxypropyl]-1,2,4-triazolidine-3-carbothialdehyde.
| Compound Name | 2-[2-(1-chlorocyclopropyl)-3-(2-chlorophenyl)-2-hydroxypropyl]-1,2,4-triazolidine-3-carbothialdehyde |
|---|---|
| PubChem CID | 175185202 |
| Molecular Formula | C15H19Cl2N3OS |
| Molecular Weight | 360.31 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | 2-[2-(1-chlorocyclopropyl)-3-(2-chlorophenyl)-2-hydroxypropyl]-1,2,4-triazolidine-3-carbothialdehyde |
| SMILES | OC(Cc1ccccc1Cl)(CN1NCNC1C=S)C1(Cl)CC1 |
| InChI | InChI=1S/C15H19Cl2N3OS/c16-12-4-2-1-3-11(12)7-15(21,14(17)5-6-14)9-20-13(8-22)18-10-19-20/h1-4,8,13,18-19,21H,5-7,9-10H2 |
| InChIKey | WDCSJQJFNUKYEA-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 47.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.31 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|