C15H21Cl2N3OS — CID 134177869
1-[6-chloro-2-[(2-chlorophenyl)methyl]-2-hydroxyhexyl]-1,2,4-triazolidine-3-thione (PubChem CID 134177869) has the molecular formula C15H21Cl2N3OS and a molecular weight of 362.33 g/mol. Its IUPAC name is 1-[6-chloro-2-[(2-chlorophenyl)methyl]-2-hydroxyhexyl]-1,2,4-triazolidine-3-thione.
| Compound Name | 1-[6-chloro-2-[(2-chlorophenyl)methyl]-2-hydroxyhexyl]-1,2,4-triazolidine-3-thione |
|---|---|
| PubChem CID | 134177869 |
| Molecular Formula | C15H21Cl2N3OS |
| Molecular Weight | 362.33 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | 1-[6-chloro-2-[(2-chlorophenyl)methyl]-2-hydroxyhexyl]-1,2,4-triazolidine-3-thione |
| SMILES | OC(CCCCCl)(Cc1ccccc1Cl)CN1CNC(=S)N1 |
| InChI | InChI=1S/C15H21Cl2N3OS/c16-8-4-3-7-15(21,10-20-11-18-14(22)19-20)9-12-5-1-2-6-13(12)17/h1-2,5-6,21H,3-4,7-11H2,(H2,18,19,22) |
| InChIKey | QAOMOTMMWFTXHS-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 47.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.33 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|