C20H18Cl2O4-2 — CID 22677243
2,2-bis[(2-chlorophenyl)methyl]hexanedioate (PubChem CID 22677243) has the molecular formula C20H18Cl2O4-2 and a molecular weight of 393.27 g/mol. Its IUPAC name is 2,2-bis[(2-chlorophenyl)methyl]hexanedioate.
| Compound Name | 2,2-bis[(2-chlorophenyl)methyl]hexanedioate |
|---|---|
| PubChem CID | 22677243 |
| Molecular Formula | C20H18Cl2O4-2 |
| Molecular Weight | 393.27 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | 2,2-bis[(2-chlorophenyl)methyl]hexanedioate |
| SMILES | O=C([O-])CCCC(Cc1ccccc1Cl)(Cc1ccccc1Cl)C(=O)[O-] |
| InChI | InChI=1S/C20H20Cl2O4/c21-16-8-3-1-6-14(16)12-20(19(25)26,11-5-10-18(23)24)13-15-7-2-4-9-17(15)22/h1-4,6-9H,5,10-13H2,(H,23,24)(H,25,26)/p-2 |
| InChIKey | GQSPWPRABKPKJC-UHFFFAOYSA-L |
| XLogP | 2.44 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.27 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |