C23H27ClO3 — CID 154097298
8-[(2-chlorophenyl)methyl]-9-oxo-8-phenyldecanoic acid (PubChem CID 154097298) has the molecular formula C23H27ClO3 and a molecular weight of 386.92 g/mol. Its IUPAC name is 8-[(2-chlorophenyl)methyl]-9-oxo-8-phenyldecanoic acid.
| Compound Name | 8-[(2-chlorophenyl)methyl]-9-oxo-8-phenyldecanoic acid |
|---|---|
| PubChem CID | 154097298 |
| Molecular Formula | C23H27ClO3 |
| Molecular Weight | 386.92 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | 8-[(2-chlorophenyl)methyl]-9-oxo-8-phenyldecanoic acid |
| SMILES | CC(=O)C(CCCCCCC(=O)O)(Cc1ccccc1Cl)c1ccccc1 |
| InChI | InChI=1S/C23H27ClO3/c1-18(25)23(20-12-5-4-6-13-20,16-10-3-2-7-15-22(26)27)17-19-11-8-9-14-21(19)24/h4-6,8-9,11-14H,2-3,7,10,15-17H2,1H3,(H,26,27) |
| InChIKey | IIBWJNKHTWUOBM-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.92 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|