C15H17Cl2N3O3S2 — CID 54346254
1-[2-(1-chlorocyclopropyl)-3-(2-chlorophenyl)-2-hydroxypropyl]-5-methoxysulfinylsulfanyl-1,2,4-triazole (PubChem CID 54346254) has the molecular formula C15H17Cl2N3O3S2 and a molecular weight of 422.36 g/mol. Its IUPAC name is 1-[2-(1-chlorocyclopropyl)-3-(2-chlorophenyl)-2-hydroxypropyl]-5-methoxysulfinylsulfanyl-1,2,4-triazole.
| Compound Name | 1-[2-(1-chlorocyclopropyl)-3-(2-chlorophenyl)-2-hydroxypropyl]-5-methoxysulfinylsulfanyl-1,2,4-triazole |
|---|---|
| PubChem CID | 54346254 |
| Molecular Formula | C15H17Cl2N3O3S2 |
| Molecular Weight | 422.36 g/mol |
| Exact Mass | 421.01 |
| IUPAC Name | 1-[2-(1-chlorocyclopropyl)-3-(2-chlorophenyl)-2-hydroxypropyl]-5-methoxysulfinylsulfanyl-1,2,4-triazole |
| SMILES | COS(=O)Sc1ncnn1CC(O)(Cc1ccccc1Cl)C1(Cl)CC1 |
| InChI | InChI=1S/C15H17Cl2N3O3S2/c1-23-25(22)24-13-18-10-19-20(13)9-15(21,14(17)6-7-14)8-11-4-2-3-5-12(11)16/h2-5,10,21H,6-9H2,1H3 |
| InChIKey | UCMVWYURJPBYRV-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.36 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|