C15H21Cl2N3OS — CID 143577895
1-chloro-2-[(1-chlorocyclopropyl)methyl]benzene;2-ethyl-1H-1,2,4-triazole-3-thione;methanol (PubChem CID 143577895) has the molecular formula C15H21Cl2N3OS and a molecular weight of 362.33 g/mol. Its IUPAC name is 1-chloro-2-[(1-chlorocyclopropyl)methyl]benzene;2-ethyl-1H-1,2,4-triazole-3-thione;methanol.
| Compound Name | 1-chloro-2-[(1-chlorocyclopropyl)methyl]benzene;2-ethyl-1H-1,2,4-triazole-3-thione;methanol |
|---|---|
| PubChem CID | 143577895 |
| Molecular Formula | C15H21Cl2N3OS |
| Molecular Weight | 362.33 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | 1-chloro-2-[(1-chlorocyclopropyl)methyl]benzene;2-ethyl-1H-1,2,4-triazole-3-thione;methanol |
| SMILES | CCn1[nH]cnc1=S.CO.Clc1ccccc1CC1(Cl)CC1 |
| InChI | InChI=1S/C10H10Cl2.C4H7N3S.CH4O/c11-9-4-2-1-3-8(9)7-10(12)5-6-10;1-2-7-4(8)5-3-6-7;1-2/h1-4H,5-7H2;3H,2H2,1H3,(H,5,6,8);2H,1H3 |
| InChIKey | INIUMWUTWUBFFY-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 53.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.33 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|