About 3-[(E)-2-(6-methyl-1,2,4,5-tetrazin-3-yl)ethenyl]quinoline
3-[(E)-2-(6-methyl-1,2,4,5-tetrazin-3-yl)ethenyl]quinoline (PubChem CID 122450322) has the molecular formula C14H11N5
and a molecular weight of 249.28 g/mol. Its IUPAC name is 3-[(E)-2-(6-methyl-1,2,4,5-tetrazin-3-yl)ethenyl]quinoline.
Molecular Properties
| Compound Name | 3-[(E)-2-(6-methyl-1,2,4,5-tetrazin-3-yl)ethenyl]quinoline |
| PubChem CID | 122450322 |
| Molecular Formula | C14H11N5 |
| Molecular Weight | 249.28 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 3-[(E)-2-(6-methyl-1,2,4,5-tetrazin-3-yl)ethenyl]quinoline |
| SMILES | Cc1nnc(/C=C/c2cnc3ccccc3c2)nn1 |
| InChI | InChI=1S/C14H11N5/c1-10-16-18-14(19-17-10)7-6-11-8-12-4-2-3-5-13(12)15-9-11/h2-9H,1H3/b7-6+ |
| InChIKey | WWCFFFHFRRIXJM-VOTSOKGWSA-N |
| XLogP | 2.29 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.28 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[(E)-2-(6-methyl-1,2,4,5-tetrazin-3-yl)ethenyl]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(E)-2-(6-methyl-1,2,4,5-tetrazin-3-yl)ethenyl]quinoline?
The IUPAC name of 3-[(E)-2-(6-methyl-1,2,4,5-tetrazin-3-yl)ethenyl]quinoline (CID 122450322) is 3-[(E)-2-(6-methyl-1,2,4,5-tetrazin-3-yl)ethenyl]quinoline.
What is the SMILES notation for 3-[(E)-2-(6-methyl-1,2,4,5-tetrazin-3-yl)ethenyl]quinoline?
The canonical SMILES for 3-[(E)-2-(6-methyl-1,2,4,5-tetrazin-3-yl)ethenyl]quinoline is Cc1nnc(/C=C/c2cnc3ccccc3c2)nn1.
What is the InChIKey of 3-[(E)-2-(6-methyl-1,2,4,5-tetrazin-3-yl)ethenyl]quinoline?
The InChIKey is WWCFFFHFRRIXJM-VOTSOKGWSA-N. The full InChI is InChI=1S/C14H11N5/c1-10-16-18-14(19-17-10)7-6-11-8-12-4-2-3-5-13(12)15-9-11/h2-9H,1H3/b7-6+.
What are the key properties of 3-[(E)-2-(6-methyl-1,2,4,5-tetrazin-3-yl)ethenyl]quinoline?
3-[(E)-2-(6-methyl-1,2,4,5-tetrazin-3-yl)ethenyl]quinoline has a molecular weight of 249.28 g/mol, XLogP of 2.29, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(E)-2-(6-methyl-1,2,4,5-tetrazin-3-yl)ethenyl]quinoline is sourced from PubChem (CID 122450322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).