C20H19IO4 — CID 177406127
(2,6-dimethylphenyl) (E)-5-(1,3-benzodioxol-5-yl)-2-iodopent-4-enoate (PubChem CID 177406127) has the molecular formula C20H19IO4 and a molecular weight of 450.27 g/mol. Its IUPAC name is (2,6-dimethylphenyl) (E)-5-(1,3-benzodioxol-5-yl)-2-iodopent-4-enoate.
| Compound Name | (2,6-dimethylphenyl) (E)-5-(1,3-benzodioxol-5-yl)-2-iodopent-4-enoate |
|---|---|
| PubChem CID | 177406127 |
| Molecular Formula | C20H19IO4 |
| Molecular Weight | 450.27 g/mol |
| Exact Mass | 450.03 |
| IUPAC Name | (2,6-dimethylphenyl) (E)-5-(1,3-benzodioxol-5-yl)-2-iodopent-4-enoate |
| SMILES | Cc1cccc(C)c1OC(=O)C(I)C/C=C/c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H19IO4/c1-13-5-3-6-14(2)19(13)25-20(22)16(21)8-4-7-15-9-10-17-18(11-15)24-12-23-17/h3-7,9-11,16H,8,12H2,1-2H3/b7-4+ |
| InChIKey | FZDMJGRHJLVZJA-QPJJXVBHSA-N |
| XLogP | 4.84 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.27 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|