C17H12F3N3O4 — CID 9333456
3-nitro-N'-[(E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoyl]benzohydrazide (PubChem CID 9333456) has the molecular formula C17H12F3N3O4 and a molecular weight of 379.29 g/mol. Its IUPAC name is 3-nitro-N'-[(E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoyl]benzohydrazide.
| Compound Name | 3-nitro-N'-[(E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoyl]benzohydrazide |
|---|---|
| PubChem CID | 9333456 |
| Molecular Formula | C17H12F3N3O4 |
| Molecular Weight | 379.29 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | 3-nitro-N'-[(E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoyl]benzohydrazide |
| SMILES | O=C(/C=C/c1ccc(C(F)(F)F)cc1)NNC(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H12F3N3O4/c18-17(19,20)13-7-4-11(5-8-13)6-9-15(24)21-22-16(25)12-2-1-3-14(10-12)23(26)27/h1-10H,(H,21,24)(H,22,25)/b9-6+ |
| InChIKey | OKLYQEDKSOOHAR-RMKNXTFCSA-N |
| XLogP | 3.09 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.29 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|