C19H18N4O6S — CID 55510645
N'-[3-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]prop-2-enoyl]-3-nitrobenzohydrazide (PubChem CID 55510645) has the molecular formula C19H18N4O6S and a molecular weight of 430.44 g/mol. Its IUPAC name is N'-[3-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]prop-2-enoyl]-3-nitrobenzohydrazide.
| Compound Name | N'-[3-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]prop-2-enoyl]-3-nitrobenzohydrazide |
|---|---|
| PubChem CID | 55510645 |
| Molecular Formula | C19H18N4O6S |
| Molecular Weight | 430.44 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | N'-[3-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]prop-2-enoyl]-3-nitrobenzohydrazide |
| SMILES | O=C(C=Cc1ccc(N2CCCS2(=O)=O)cc1)NNC(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H18N4O6S/c24-18(20-21-19(25)15-3-1-4-17(13-15)23(26)27)10-7-14-5-8-16(9-6-14)22-11-2-12-30(22,28)29/h1,3-10,13H,2,11-12H2,(H,20,24)(H,21,25) |
| InChIKey | VPUZKEVGSMZSRV-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 138.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.44 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|