C18H16ClN3O5S — CID 72685438
N-[2-chloro-5-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-3-(3-nitrophenyl)prop-2-enamide (PubChem CID 72685438) has the molecular formula C18H16ClN3O5S and a molecular weight of 421.86 g/mol. Its IUPAC name is N-[2-chloro-5-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-3-(3-nitrophenyl)prop-2-enamide.
| Compound Name | N-[2-chloro-5-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-3-(3-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 72685438 |
| Molecular Formula | C18H16ClN3O5S |
| Molecular Weight | 421.86 g/mol |
| Exact Mass | 421.05 |
| IUPAC Name | N-[2-chloro-5-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-3-(3-nitrophenyl)prop-2-enamide |
| SMILES | O=C(C=Cc1cccc([N+](=O)[O-])c1)Nc1cc(N2CCCS2(=O)=O)ccc1Cl |
| InChI | InChI=1S/C18H16ClN3O5S/c19-16-7-6-14(21-9-2-10-28(21,26)27)12-17(16)20-18(23)8-5-13-3-1-4-15(11-13)22(24)25/h1,3-8,11-12H,2,9-10H2,(H,20,23) |
| InChIKey | BSSBCJGKRHRGJD-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.86 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|