C17H17ClN2O4S — CID 72685448
N-[2-chloro-5-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-3-(5-methylfuran-2-yl)prop-2-enamide (PubChem CID 72685448) has the molecular formula C17H17ClN2O4S and a molecular weight of 380.85 g/mol. Its IUPAC name is N-[2-chloro-5-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-3-(5-methylfuran-2-yl)prop-2-enamide.
| Compound Name | N-[2-chloro-5-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-3-(5-methylfuran-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 72685448 |
| Molecular Formula | C17H17ClN2O4S |
| Molecular Weight | 380.85 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | N-[2-chloro-5-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-3-(5-methylfuran-2-yl)prop-2-enamide |
| SMILES | Cc1ccc(C=CC(=O)Nc2cc(N3CCCS3(=O)=O)ccc2Cl)o1 |
| InChI | InChI=1S/C17H17ClN2O4S/c1-12-3-5-14(24-12)6-8-17(21)19-16-11-13(4-7-15(16)18)20-9-2-10-25(20,22)23/h3-8,11H,2,9-10H2,1H3,(H,19,21) |
| InChIKey | JTDZGNDWXWDJJU-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.85 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|