C19H18ClN3O4 — CID 3380816
N-[4-chloro-3-[3-(3-nitrophenyl)prop-2-enoylamino]phenyl]butanamide (PubChem CID 3380816) has the molecular formula C19H18ClN3O4 and a molecular weight of 387.82 g/mol. Its IUPAC name is N-[4-chloro-3-[3-(3-nitrophenyl)prop-2-enoylamino]phenyl]butanamide.
| Compound Name | N-[4-chloro-3-[3-(3-nitrophenyl)prop-2-enoylamino]phenyl]butanamide |
|---|---|
| PubChem CID | 3380816 |
| Molecular Formula | C19H18ClN3O4 |
| Molecular Weight | 387.82 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | N-[4-chloro-3-[3-(3-nitrophenyl)prop-2-enoylamino]phenyl]butanamide |
| SMILES | CCCC(=O)Nc1ccc(Cl)c(NC(=O)C=Cc2cccc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C19H18ClN3O4/c1-2-4-18(24)21-14-8-9-16(20)17(12-14)22-19(25)10-7-13-5-3-6-15(11-13)23(26)27/h3,5-12H,2,4H2,1H3,(H,21,24)(H,22,25) |
| InChIKey | NWWQOXLDECHCKC-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.82 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|