C27H23N5O3 — CID 55615757
N'-(5-oxo-1-phenylpyrrolidine-3-carbonyl)-1,3-diphenylpyrazole-4-carbohydrazide (PubChem CID 55615757) has the molecular formula C27H23N5O3 and a molecular weight of 465.51 g/mol. Its IUPAC name is N'-(5-oxo-1-phenylpyrrolidine-3-carbonyl)-1,3-diphenylpyrazole-4-carbohydrazide.
| Compound Name | N'-(5-oxo-1-phenylpyrrolidine-3-carbonyl)-1,3-diphenylpyrazole-4-carbohydrazide |
|---|---|
| PubChem CID | 55615757 |
| Molecular Formula | C27H23N5O3 |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.18 |
| IUPAC Name | N'-(5-oxo-1-phenylpyrrolidine-3-carbonyl)-1,3-diphenylpyrazole-4-carbohydrazide |
| SMILES | O=C(NNC(=O)C1CC(=O)N(c2ccccc2)C1)c1cn(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C27H23N5O3/c33-24-16-20(17-31(24)21-12-6-2-7-13-21)26(34)28-29-27(35)23-18-32(22-14-8-3-9-15-22)30-25(23)19-10-4-1-5-11-19/h1-15,18,20H,16-17H2,(H,28,34)(H,29,35) |
| InChIKey | AGONZRSSRNMXGT-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|