C27H44ClNO4Si — CID 58539874
tert-butyl 4-[5-chloro-2-[tri(propan-2-yl)silyloxymethyl]benzoyl]piperidine-1-carboxylate (PubChem CID 58539874) has the molecular formula C27H44ClNO4Si and a molecular weight of 510.19 g/mol. Its IUPAC name is tert-butyl 4-[5-chloro-2-[tri(propan-2-yl)silyloxymethyl]benzoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[5-chloro-2-[tri(propan-2-yl)silyloxymethyl]benzoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 58539874 |
| Molecular Formula | C27H44ClNO4Si |
| Molecular Weight | 510.19 g/mol |
| Exact Mass | 509.27 |
| IUPAC Name | tert-butyl 4-[5-chloro-2-[tri(propan-2-yl)silyloxymethyl]benzoyl]piperidine-1-carboxylate |
| SMILES | CC(C)[Si](OCc1ccc(Cl)cc1C(=O)C1CCN(C(=O)OC(C)(C)C)CC1)(C(C)C)C(C)C |
| InChI | InChI=1S/C27H44ClNO4Si/c1-18(2)34(19(3)4,20(5)6)32-17-22-10-11-23(28)16-24(22)25(30)21-12-14-29(15-13-21)26(31)33-27(7,8)9/h10-11,16,18-21H,12-15,17H2,1-9H3 |
| InChIKey | PXXZYOPCPKUTNL-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.19 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|