C18H26BrNO4S — CID 148568248
tert-butyl 4-[(4-bromophenyl)methylsulfonylmethyl]piperidine-1-carboxylate (PubChem CID 148568248) has the molecular formula C18H26BrNO4S and a molecular weight of 432.38 g/mol. Its IUPAC name is tert-butyl 4-[(4-bromophenyl)methylsulfonylmethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(4-bromophenyl)methylsulfonylmethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 148568248 |
| Molecular Formula | C18H26BrNO4S |
| Molecular Weight | 432.38 g/mol |
| Exact Mass | 431.08 |
| IUPAC Name | tert-butyl 4-[(4-bromophenyl)methylsulfonylmethyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CS(=O)(=O)Cc2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C18H26BrNO4S/c1-18(2,3)24-17(21)20-10-8-15(9-11-20)13-25(22,23)12-14-4-6-16(19)7-5-14/h4-7,15H,8-13H2,1-3H3 |
| InChIKey | MWJDANWHRJKKHR-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.38 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |