C22H31N5O4 — CID 68636592
4-[6-methoxy-7-(3-piperidin-3-ylpropoxy)quinazolin-4-yl]piperazine-1-carboxylic acid (PubChem CID 68636592) has the molecular formula C22H31N5O4 and a molecular weight of 429.52 g/mol. Its IUPAC name is 4-[6-methoxy-7-(3-piperidin-3-ylpropoxy)quinazolin-4-yl]piperazine-1-carboxylic acid.
| Compound Name | 4-[6-methoxy-7-(3-piperidin-3-ylpropoxy)quinazolin-4-yl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 68636592 |
| Molecular Formula | C22H31N5O4 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | 4-[6-methoxy-7-(3-piperidin-3-ylpropoxy)quinazolin-4-yl]piperazine-1-carboxylic acid |
| SMILES | COc1cc2c(N3CCN(C(=O)O)CC3)ncnc2cc1OCCCC1CCCNC1 |
| InChI | InChI=1S/C22H31N5O4/c1-30-19-12-17-18(13-20(19)31-11-3-5-16-4-2-6-23-14-16)24-15-25-21(17)26-7-9-27(10-8-26)22(28)29/h12-13,15-16,23H,2-11,14H2,1H3,(H,28,29) |
| InChIKey | POPRSWSDJDUCOP-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 100.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|