C21H23N5S — CID 22707600
N-benzyl-4-(5-methylquinazolin-4-yl)piperazine-1-carbothioamide (PubChem CID 22707600) has the molecular formula C21H23N5S and a molecular weight of 377.52 g/mol. Its IUPAC name is N-benzyl-4-(5-methylquinazolin-4-yl)piperazine-1-carbothioamide.
| Compound Name | N-benzyl-4-(5-methylquinazolin-4-yl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 22707600 |
| Molecular Formula | C21H23N5S |
| Molecular Weight | 377.52 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | N-benzyl-4-(5-methylquinazolin-4-yl)piperazine-1-carbothioamide |
| SMILES | Cc1cccc2ncnc(N3CCN(C(=S)NCc4ccccc4)CC3)c12 |
| InChI | InChI=1S/C21H23N5S/c1-16-6-5-9-18-19(16)20(24-15-23-18)25-10-12-26(13-11-25)21(27)22-14-17-7-3-2-4-8-17/h2-9,15H,10-14H2,1H3,(H,22,27) |
| InChIKey | RLSFSYALTVSTQD-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.52 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|