C20H22N4S2 — CID 8696465
4-(1,3-benzothiazol-2-ylmethyl)-N-benzylpiperazine-1-carbothioamide (PubChem CID 8696465) has the molecular formula C20H22N4S2 and a molecular weight of 382.56 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-ylmethyl)-N-benzylpiperazine-1-carbothioamide.
| Compound Name | 4-(1,3-benzothiazol-2-ylmethyl)-N-benzylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 8696465 |
| Molecular Formula | C20H22N4S2 |
| Molecular Weight | 382.56 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | 4-(1,3-benzothiazol-2-ylmethyl)-N-benzylpiperazine-1-carbothioamide |
| SMILES | S=C(NCc1ccccc1)N1CCN(Cc2nc3ccccc3s2)CC1 |
| InChI | InChI=1S/C20H22N4S2/c25-20(21-14-16-6-2-1-3-7-16)24-12-10-23(11-13-24)15-19-22-17-8-4-5-9-18(17)26-19/h1-9H,10-15H2,(H,21,25) |
| InChIKey | NHEMDBJBLLCUMK-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.56 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|