C19H18F2N4O2S — CID 133345227
4-[4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]-5-methylquinazoline (PubChem CID 133345227) has the molecular formula C19H18F2N4O2S and a molecular weight of 404.44 g/mol. Its IUPAC name is 4-[4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]-5-methylquinazoline.
| Compound Name | 4-[4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]-5-methylquinazoline |
|---|---|
| PubChem CID | 133345227 |
| Molecular Formula | C19H18F2N4O2S |
| Molecular Weight | 404.44 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | 4-[4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]-5-methylquinazoline |
| SMILES | Cc1cccc2ncnc(N3CCN(S(=O)(=O)c4c(F)cccc4F)CC3)c12 |
| InChI | InChI=1S/C19H18F2N4O2S/c1-13-4-2-7-16-17(13)19(23-12-22-16)24-8-10-25(11-9-24)28(26,27)18-14(20)5-3-6-15(18)21/h2-7,12H,8-11H2,1H3 |
| InChIKey | OKMVRUFMZDILSZ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.44 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |