C24H20F2N4O2S — CID 46093769
2-[4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]-3-phenylquinoxaline (PubChem CID 46093769) has the molecular formula C24H20F2N4O2S and a molecular weight of 466.51 g/mol. Its IUPAC name is 2-[4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]-3-phenylquinoxaline.
| Compound Name | 2-[4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]-3-phenylquinoxaline |
|---|---|
| PubChem CID | 46093769 |
| Molecular Formula | C24H20F2N4O2S |
| Molecular Weight | 466.51 g/mol |
| Exact Mass | 466.13 |
| IUPAC Name | 2-[4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]-3-phenylquinoxaline |
| SMILES | O=S(=O)(c1c(F)cccc1F)N1CCN(c2nc3ccccc3nc2-c2ccccc2)CC1 |
| InChI | InChI=1S/C24H20F2N4O2S/c25-18-9-6-10-19(26)23(18)33(31,32)30-15-13-29(14-16-30)24-22(17-7-2-1-3-8-17)27-20-11-4-5-12-21(20)28-24/h1-12H,13-16H2 |
| InChIKey | LSTGCZZXIGVDQA-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.51 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |