C19H19FN4O5S — CID 55854470
ethyl 5-[4-(5-fluoroquinazolin-4-yl)piperazin-1-yl]sulfonylfuran-2-carboxylate (PubChem CID 55854470) has the molecular formula C19H19FN4O5S and a molecular weight of 434.45 g/mol. Its IUPAC name is ethyl 5-[4-(5-fluoroquinazolin-4-yl)piperazin-1-yl]sulfonylfuran-2-carboxylate.
| Compound Name | ethyl 5-[4-(5-fluoroquinazolin-4-yl)piperazin-1-yl]sulfonylfuran-2-carboxylate |
|---|---|
| PubChem CID | 55854470 |
| Molecular Formula | C19H19FN4O5S |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | ethyl 5-[4-(5-fluoroquinazolin-4-yl)piperazin-1-yl]sulfonylfuran-2-carboxylate |
| SMILES | CCOC(=O)c1ccc(S(=O)(=O)N2CCN(c3ncnc4cccc(F)c34)CC2)o1 |
| InChI | InChI=1S/C19H19FN4O5S/c1-2-28-19(25)15-6-7-16(29-15)30(26,27)24-10-8-23(9-11-24)18-17-13(20)4-3-5-14(17)21-12-22-18/h3-7,12H,2,8-11H2,1H3 |
| InChIKey | SBBBKIZHMLBMCD-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 105.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |