C19H20N4O5S — CID 47053917
ethyl 5-(4-quinazolin-4-ylpiperazin-1-yl)sulfonylfuran-2-carboxylate (PubChem CID 47053917) has the molecular formula C19H20N4O5S and a molecular weight of 416.46 g/mol. Its IUPAC name is ethyl 5-(4-quinazolin-4-ylpiperazin-1-yl)sulfonylfuran-2-carboxylate.
| Compound Name | ethyl 5-(4-quinazolin-4-ylpiperazin-1-yl)sulfonylfuran-2-carboxylate |
|---|---|
| PubChem CID | 47053917 |
| Molecular Formula | C19H20N4O5S |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | ethyl 5-(4-quinazolin-4-ylpiperazin-1-yl)sulfonylfuran-2-carboxylate |
| SMILES | CCOC(=O)c1ccc(S(=O)(=O)N2CCN(c3ncnc4ccccc34)CC2)o1 |
| InChI | InChI=1S/C19H20N4O5S/c1-2-27-19(24)16-7-8-17(28-16)29(25,26)23-11-9-22(10-12-23)18-14-5-3-4-6-15(14)20-13-21-18/h3-8,13H,2,9-12H2,1H3 |
| InChIKey | XGYBCSZCBRQDBJ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 105.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |