C20H20N2O6S2 — CID 46464437
ethyl 5-[4-(1-benzothiophene-2-carbonyl)piperazin-1-yl]sulfonylfuran-2-carboxylate (PubChem CID 46464437) has the molecular formula C20H20N2O6S2 and a molecular weight of 448.52 g/mol. Its IUPAC name is ethyl 5-[4-(1-benzothiophene-2-carbonyl)piperazin-1-yl]sulfonylfuran-2-carboxylate.
| Compound Name | ethyl 5-[4-(1-benzothiophene-2-carbonyl)piperazin-1-yl]sulfonylfuran-2-carboxylate |
|---|---|
| PubChem CID | 46464437 |
| Molecular Formula | C20H20N2O6S2 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.08 |
| IUPAC Name | ethyl 5-[4-(1-benzothiophene-2-carbonyl)piperazin-1-yl]sulfonylfuran-2-carboxylate |
| SMILES | CCOC(=O)c1ccc(S(=O)(=O)N2CCN(C(=O)c3cc4ccccc4s3)CC2)o1 |
| InChI | InChI=1S/C20H20N2O6S2/c1-2-27-20(24)15-7-8-18(28-15)30(25,26)22-11-9-21(10-12-22)19(23)17-13-14-5-3-4-6-16(14)29-17/h3-8,13H,2,9-12H2,1H3 |
| InChIKey | OHEYCELZTDDPAP-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 97.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |