C20H24N2O8S2 — CID 55961526
ethyl 5-[4-(2-ethylsulfonylbenzoyl)piperazin-1-yl]sulfonylfuran-2-carboxylate (PubChem CID 55961526) has the molecular formula C20H24N2O8S2 and a molecular weight of 484.55 g/mol. Its IUPAC name is ethyl 5-[4-(2-ethylsulfonylbenzoyl)piperazin-1-yl]sulfonylfuran-2-carboxylate.
| Compound Name | ethyl 5-[4-(2-ethylsulfonylbenzoyl)piperazin-1-yl]sulfonylfuran-2-carboxylate |
|---|---|
| PubChem CID | 55961526 |
| Molecular Formula | C20H24N2O8S2 |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.10 |
| IUPAC Name | ethyl 5-[4-(2-ethylsulfonylbenzoyl)piperazin-1-yl]sulfonylfuran-2-carboxylate |
| SMILES | CCOC(=O)c1ccc(S(=O)(=O)N2CCN(C(=O)c3ccccc3S(=O)(=O)CC)CC2)o1 |
| InChI | InChI=1S/C20H24N2O8S2/c1-3-29-20(24)16-9-10-18(30-16)32(27,28)22-13-11-21(12-14-22)19(23)15-7-5-6-8-17(15)31(25,26)4-2/h5-10H,3-4,11-14H2,1-2H3 |
| InChIKey | NGCJYGWOMXXFGP-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 131.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |