C16H18ClN5S — CID 969906
N-[(4-chlorophenyl)methyl]-4-pyrimidin-2-ylpiperazine-1-carbothioamide (PubChem CID 969906) has the molecular formula C16H18ClN5S and a molecular weight of 347.88 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-4-pyrimidin-2-ylpiperazine-1-carbothioamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-4-pyrimidin-2-ylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 969906 |
| Molecular Formula | C16H18ClN5S |
| Molecular Weight | 347.88 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-4-pyrimidin-2-ylpiperazine-1-carbothioamide |
| SMILES | S=C(NCc1ccc(Cl)cc1)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C16H18ClN5S/c17-14-4-2-13(3-5-14)12-20-16(23)22-10-8-21(9-11-22)15-18-6-1-7-19-15/h1-7H,8-12H2,(H,20,23) |
| InChIKey | VYIFYDHXGYAAEK-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.88 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|