C12H19N3O3 — CID 89277781
N-[2-(dimethylamino)ethyl]-4-(hydroxyamino)-3-methoxybenzamide (PubChem CID 89277781) has the molecular formula C12H19N3O3 and a molecular weight of 253.30 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-4-(hydroxyamino)-3-methoxybenzamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-4-(hydroxyamino)-3-methoxybenzamide |
|---|---|
| PubChem CID | 89277781 |
| Molecular Formula | C12H19N3O3 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-4-(hydroxyamino)-3-methoxybenzamide |
| SMILES | COc1cc(C(=O)NCCN(C)C)ccc1NO |
| InChI | InChI=1S/C12H19N3O3/c1-15(2)7-6-13-12(16)9-4-5-10(14-17)11(8-9)18-3/h4-5,8,14,17H,6-7H2,1-3H3,(H,13,16) |
| InChIKey | IFOROYLFMNZLQK-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|