C17H24N2O5S — CID 7423397
N-[2-(cycloheptylsulfamoyl)ethyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 7423397) has the molecular formula C17H24N2O5S and a molecular weight of 368.46 g/mol. Its IUPAC name is N-[2-(cycloheptylsulfamoyl)ethyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[2-(cycloheptylsulfamoyl)ethyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 7423397 |
| Molecular Formula | C17H24N2O5S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | N-[2-(cycloheptylsulfamoyl)ethyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(NCCS(=O)(=O)NC1CCCCCC1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H24N2O5S/c20-17(13-7-8-15-16(11-13)24-12-23-15)18-9-10-25(21,22)19-14-5-3-1-2-4-6-14/h7-8,11,14,19H,1-6,9-10,12H2,(H,18,20) |
| InChIKey | IZNAQNVSYQWDJV-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |