C24H31N3O5 — CID 108557899
4-(dimethylamino)-N-[1-(3,4,5-trimethoxybenzoyl)piperidin-4-yl]benzamide (PubChem CID 108557899) has the molecular formula C24H31N3O5 and a molecular weight of 441.53 g/mol. Its IUPAC name is 4-(dimethylamino)-N-[1-(3,4,5-trimethoxybenzoyl)piperidin-4-yl]benzamide.
| Compound Name | 4-(dimethylamino)-N-[1-(3,4,5-trimethoxybenzoyl)piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 108557899 |
| Molecular Formula | C24H31N3O5 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | 4-(dimethylamino)-N-[1-(3,4,5-trimethoxybenzoyl)piperidin-4-yl]benzamide |
| SMILES | COc1cc(C(=O)N2CCC(NC(=O)c3ccc(N(C)C)cc3)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C24H31N3O5/c1-26(2)19-8-6-16(7-9-19)23(28)25-18-10-12-27(13-11-18)24(29)17-14-20(30-3)22(32-5)21(15-17)31-4/h6-9,14-15,18H,10-13H2,1-5H3,(H,25,28) |
| InChIKey | OBBNXIXPMNLJNO-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |