C19H32Cl2IN5 — CID 111197621
2-[(2,4-dichlorophenyl)methyl]-1-ethyl-3-[2-(4-ethylpiperazin-1-yl)propyl]guanidine;hydroiodide (PubChem CID 111197621) has the molecular formula C19H32Cl2IN5 and a molecular weight of 528.31 g/mol. Its IUPAC name is 2-[(2,4-dichlorophenyl)methyl]-1-ethyl-3-[2-(4-ethylpiperazin-1-yl)propyl]guanidine;hydroiodide.
| Compound Name | 2-[(2,4-dichlorophenyl)methyl]-1-ethyl-3-[2-(4-ethylpiperazin-1-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111197621 |
| Molecular Formula | C19H32Cl2IN5 |
| Molecular Weight | 528.31 g/mol |
| Exact Mass | 527.11 |
| IUPAC Name | 2-[(2,4-dichlorophenyl)methyl]-1-ethyl-3-[2-(4-ethylpiperazin-1-yl)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(Cl)cc1Cl)NCC(C)N1CCN(CC)CC1.I |
| InChI | InChI=1S/C19H31Cl2N5.HI/c1-4-22-19(24-14-16-6-7-17(20)12-18(16)21)23-13-15(3)26-10-8-25(5-2)9-11-26;/h6-7,12,15H,4-5,8-11,13-14H2,1-3H3,(H2,22,23,24);1H |
| InChIKey | XFYQXTBPLKZUGX-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 42.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.31 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|