C20H34N6O — CID 111995395
N-[2-[[ethylamino-[[1-(6-methyl-2-pyridinyl)piperidin-4-yl]amino]methylidene]amino]ethyl]-2-methylpropanamide (PubChem CID 111995395) has the molecular formula C20H34N6O and a molecular weight of 374.53 g/mol. Its IUPAC name is N-[2-[[ethylamino-[[1-(6-methyl-2-pyridinyl)piperidin-4-yl]amino]methylidene]amino]ethyl]-2-methylpropanamide.
| Compound Name | N-[2-[[ethylamino-[[1-(6-methyl-2-pyridinyl)piperidin-4-yl]amino]methylidene]amino]ethyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 111995395 |
| Molecular Formula | C20H34N6O |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.28 |
| IUPAC Name | N-[2-[[ethylamino-[[1-(6-methyl-2-pyridinyl)piperidin-4-yl]amino]methylidene]amino]ethyl]-2-methylpropanamide |
| SMILES | CCN/C(=N\CCNC(=O)C(C)C)NC1CCN(c2cccc(C)n2)CC1 |
| InChI | InChI=1S/C20H34N6O/c1-5-21-20(23-12-11-22-19(27)15(2)3)25-17-9-13-26(14-10-17)18-8-6-7-16(4)24-18/h6-8,15,17H,5,9-14H2,1-4H3,(H,22,27)(H2,21,23,25) |
| InChIKey | JXLFIKDDNHVMFP-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|