C21H42IN3O2S — CID 109437142
2-[(2-tert-butyloxan-3-yl)methyl]-1-ethyl-3-(3-ethylsulfinylcyclohexyl)guanidine;hydroiodide (PubChem CID 109437142) has the molecular formula C21H42IN3O2S and a molecular weight of 527.56 g/mol. Its IUPAC name is 2-[(2-tert-butyloxan-3-yl)methyl]-1-ethyl-3-(3-ethylsulfinylcyclohexyl)guanidine;hydroiodide.
| Compound Name | 2-[(2-tert-butyloxan-3-yl)methyl]-1-ethyl-3-(3-ethylsulfinylcyclohexyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109437142 |
| Molecular Formula | C21H42IN3O2S |
| Molecular Weight | 527.56 g/mol |
| Exact Mass | 527.20 |
| IUPAC Name | 2-[(2-tert-butyloxan-3-yl)methyl]-1-ethyl-3-(3-ethylsulfinylcyclohexyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC1CCCOC1C(C)(C)C)NC1CCCC(S(=O)CC)C1.I |
| InChI | InChI=1S/C21H41N3O2S.HI/c1-6-22-20(24-17-11-8-12-18(14-17)27(25)7-2)23-15-16-10-9-13-26-19(16)21(3,4)5;/h16-19H,6-15H2,1-5H3,(H2,22,23,24);1H |
| InChIKey | QAQXCQIFYMDBJG-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.56 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|