C17H32N4O3 — CID 95765263
ethyl 4-[[(2R)-1-ethylpiperidin-2-yl]methylcarbamoylamino]piperidine-1-carboxylate (PubChem CID 95765263) has the molecular formula C17H32N4O3 and a molecular weight of 340.47 g/mol. Its IUPAC name is ethyl 4-[[(2R)-1-ethylpiperidin-2-yl]methylcarbamoylamino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[(2R)-1-ethylpiperidin-2-yl]methylcarbamoylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 95765263 |
| Molecular Formula | C17H32N4O3 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.25 |
| IUPAC Name | ethyl 4-[[(2R)-1-ethylpiperidin-2-yl]methylcarbamoylamino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)NC[C@H]2CCCCN2CC)CC1 |
| InChI | InChI=1S/C17H32N4O3/c1-3-20-10-6-5-7-15(20)13-18-16(22)19-14-8-11-21(12-9-14)17(23)24-4-2/h14-15H,3-13H2,1-2H3,(H2,18,19,22)/t15-/m1/s1 |
| InChIKey | GHIMQZDTRRVGQX-OAHLLOKOSA-N |
| XLogP | 1.78 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |