C19H29IN4O4S — CID 111140942
N-[3-[[[[(1,1-dioxothiolan-3-yl)amino]-(ethylamino)methylidene]amino]methyl]phenyl]oxolane-2-carboxamide;hydroiodide (PubChem CID 111140942) has the molecular formula C19H29IN4O4S and a molecular weight of 536.44 g/mol. Its IUPAC name is N-[3-[[[[(1,1-dioxothiolan-3-yl)amino]-(ethylamino)methylidene]amino]methyl]phenyl]oxolane-2-carboxamide;hydroiodide.
| Compound Name | N-[3-[[[[(1,1-dioxothiolan-3-yl)amino]-(ethylamino)methylidene]amino]methyl]phenyl]oxolane-2-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111140942 |
| Molecular Formula | C19H29IN4O4S |
| Molecular Weight | 536.44 g/mol |
| Exact Mass | 536.10 |
| IUPAC Name | N-[3-[[[[(1,1-dioxothiolan-3-yl)amino]-(ethylamino)methylidene]amino]methyl]phenyl]oxolane-2-carboxamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(NC(=O)C2CCCO2)c1)NC1CCS(=O)(=O)C1.I |
| InChI | InChI=1S/C19H28N4O4S.HI/c1-2-20-19(23-16-8-10-28(25,26)13-16)21-12-14-5-3-6-15(11-14)22-18(24)17-7-4-9-27-17;/h3,5-6,11,16-17H,2,4,7-10,12-13H2,1H3,(H,22,24)(H2,20,21,23);1H |
| InChIKey | RXHPCAVXDMAJIA-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 108.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.44 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|