C23H35N5O4 — CID 111328988
ethyl 4-[[N-ethyl-N'-[[3-(oxolane-2-carbonylamino)phenyl]methyl]carbamimidoyl]amino]piperidine-1-carboxylate (PubChem CID 111328988) has the molecular formula C23H35N5O4 and a molecular weight of 445.56 g/mol. Its IUPAC name is ethyl 4-[[N-ethyl-N'-[[3-(oxolane-2-carbonylamino)phenyl]methyl]carbamimidoyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[N-ethyl-N'-[[3-(oxolane-2-carbonylamino)phenyl]methyl]carbamimidoyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 111328988 |
| Molecular Formula | C23H35N5O4 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.27 |
| IUPAC Name | ethyl 4-[[N-ethyl-N'-[[3-(oxolane-2-carbonylamino)phenyl]methyl]carbamimidoyl]amino]piperidine-1-carboxylate |
| SMILES | CCN/C(=N\Cc1cccc(NC(=O)C2CCCO2)c1)NC1CCN(C(=O)OCC)CC1 |
| InChI | InChI=1S/C23H35N5O4/c1-3-24-22(27-18-10-12-28(13-11-18)23(30)31-4-2)25-16-17-7-5-8-19(15-17)26-21(29)20-9-6-14-32-20/h5,7-8,15,18,20H,3-4,6,9-14,16H2,1-2H3,(H,26,29)(H2,24,25,27) |
| InChIKey | SBDQVVCHQFLXNI-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|