C15H19N3O3S — CID 129367988
1-[(3R)-1,1-dioxothiolan-3-yl]-3-[2-(1H-indol-3-yl)ethyl]urea (PubChem CID 129367988) has the molecular formula C15H19N3O3S and a molecular weight of 321.40 g/mol. Its IUPAC name is 1-[(3R)-1,1-dioxothiolan-3-yl]-3-[2-(1H-indol-3-yl)ethyl]urea.
| Compound Name | 1-[(3R)-1,1-dioxothiolan-3-yl]-3-[2-(1H-indol-3-yl)ethyl]urea |
|---|---|
| PubChem CID | 129367988 |
| Molecular Formula | C15H19N3O3S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 1-[(3R)-1,1-dioxothiolan-3-yl]-3-[2-(1H-indol-3-yl)ethyl]urea |
| SMILES | O=C(NCCc1c[nH]c2ccccc12)N[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H19N3O3S/c19-15(18-12-6-8-22(20,21)10-12)16-7-5-11-9-17-14-4-2-1-3-13(11)14/h1-4,9,12,17H,5-8,10H2,(H2,16,18,19)/t12-/m1/s1 |
| InChIKey | RIANMEOZWOBTPI-GFCCVEGCSA-N |
| XLogP | 1.20 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |