C21H25N3O5S — CID 67715252
2-[4-[[3-(2-aminoethyl)-1H-indol-5-yl]oxy]butylsulfamoyl]benzoic acid (PubChem CID 67715252) has the molecular formula C21H25N3O5S and a molecular weight of 431.51 g/mol. Its IUPAC name is 2-[4-[[3-(2-aminoethyl)-1H-indol-5-yl]oxy]butylsulfamoyl]benzoic acid.
| Compound Name | 2-[4-[[3-(2-aminoethyl)-1H-indol-5-yl]oxy]butylsulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 67715252 |
| Molecular Formula | C21H25N3O5S |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | 2-[4-[[3-(2-aminoethyl)-1H-indol-5-yl]oxy]butylsulfamoyl]benzoic acid |
| SMILES | NCCc1c[nH]c2ccc(OCCCCNS(=O)(=O)c3ccccc3C(=O)O)cc12 |
| InChI | InChI=1S/C21H25N3O5S/c22-10-9-15-14-23-19-8-7-16(13-18(15)19)29-12-4-3-11-24-30(27,28)20-6-2-1-5-17(20)21(25)26/h1-2,5-8,13-14,23-24H,3-4,9-12,22H2,(H,25,26) |
| InChIKey | JXTXMUCBHURUOA-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 134.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|