C12H16Cl3N — CID 87988767
(2,4-dichlorophenyl)methyl-dimethyl-prop-2-enylazanium chloride (PubChem CID 87988767) has the molecular formula C12H16Cl3N and a molecular weight of 280.63 g/mol. Its IUPAC name is (2,4-dichlorophenyl)methyl-dimethyl-prop-2-enylazanium chloride.
| Compound Name | (2,4-dichlorophenyl)methyl-dimethyl-prop-2-enylazanium chloride |
|---|---|
| PubChem CID | 87988767 |
| Molecular Formula | C12H16Cl3N |
| Molecular Weight | 280.63 g/mol |
| Exact Mass | 279.03 |
| IUPAC Name | (2,4-dichlorophenyl)methyl-dimethyl-prop-2-enylazanium chloride |
| SMILES | C=CC[N+](C)(C)Cc1ccc(Cl)cc1Cl.[Cl-] |
| InChI | InChI=1S/C12H16Cl2N.ClH/c1-4-7-15(2,3)9-10-5-6-11(13)8-12(10)14;/h4-6,8H,1,7,9H2,2-3H3;1H/q+1;/p-1 |
| InChIKey | KVIFRZYPABKDOY-UHFFFAOYSA-M |
| XLogP | 0.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.63 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|