C12H15ClF2N2O3S — CID 107492878
N-[4-[2-chloroethyl(2,2-difluoroethyl)sulfamoyl]phenyl]acetamide (PubChem CID 107492878) has the molecular formula C12H15ClF2N2O3S and a molecular weight of 340.78 g/mol. Its IUPAC name is N-[4-[2-chloroethyl(2,2-difluoroethyl)sulfamoyl]phenyl]acetamide.
| Compound Name | N-[4-[2-chloroethyl(2,2-difluoroethyl)sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 107492878 |
| Molecular Formula | C12H15ClF2N2O3S |
| Molecular Weight | 340.78 g/mol |
| Exact Mass | 340.05 |
| IUPAC Name | N-[4-[2-chloroethyl(2,2-difluoroethyl)sulfamoyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N(CCCl)CC(F)F)cc1 |
| InChI | InChI=1S/C12H15ClF2N2O3S/c1-9(18)16-10-2-4-11(5-3-10)21(19,20)17(7-6-13)8-12(14)15/h2-5,12H,6-8H2,1H3,(H,16,18) |
| InChIKey | QNTGUPJGCUZEBA-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.78 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|