C10H18N2O2S2 — CID 28708007
N-(2-aminoethyl)-5-methyl-N-propan-2-ylthiophene-2-sulfonamide (PubChem CID 28708007) has the molecular formula C10H18N2O2S2 and a molecular weight of 262.40 g/mol. Its IUPAC name is N-(2-aminoethyl)-5-methyl-N-propan-2-ylthiophene-2-sulfonamide.
| Compound Name | N-(2-aminoethyl)-5-methyl-N-propan-2-ylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 28708007 |
| Molecular Formula | C10H18N2O2S2 |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | N-(2-aminoethyl)-5-methyl-N-propan-2-ylthiophene-2-sulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CCN)C(C)C)s1 |
| InChI | InChI=1S/C10H18N2O2S2/c1-8(2)12(7-6-11)16(13,14)10-5-4-9(3)15-10/h4-5,8H,6-7,11H2,1-3H3 |
| InChIKey | JDWYJBQIONEXCK-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |